C11H15NO5S — CID 123552933
(2,5-dihydroxypyrrol-1-yl) 2-pentanoylsulfanylacetate (PubChem CID 123552933) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 2-pentanoylsulfanylacetate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 2-pentanoylsulfanylacetate |
|---|---|
| PubChem CID | 123552933 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 2-pentanoylsulfanylacetate |
| SMILES | CCCCC(=O)SCC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C11H15NO5S/c1-2-3-4-11(16)18-7-10(15)17-12-8(13)5-6-9(12)14/h5-6,13-14H,2-4,7H2,1H3 |
| InChIKey | HKINENCBWNTHRS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|