C16H18N2O9 — CID 91473077
bis(2,5-dihydroxypyrrol-1-yl) 3-propanoylpentanedioate (PubChem CID 91473077) has the molecular formula C16H18N2O9 and a molecular weight of 382.33 g/mol. Its IUPAC name is bis(2,5-dihydroxypyrrol-1-yl) 3-propanoylpentanedioate.
| Compound Name | bis(2,5-dihydroxypyrrol-1-yl) 3-propanoylpentanedioate |
|---|---|
| PubChem CID | 91473077 |
| Molecular Formula | C16H18N2O9 |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | bis(2,5-dihydroxypyrrol-1-yl) 3-propanoylpentanedioate |
| SMILES | CCC(=O)C(CC(=O)On1c(O)ccc1O)CC(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C16H18N2O9/c1-2-10(19)9(7-15(24)26-17-11(20)3-4-12(17)21)8-16(25)27-18-13(22)5-6-14(18)23/h3-6,9,20-23H,2,7-8H2,1H3 |
| InChIKey | AGBOOVHKPOMZKD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 160.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |