C10H15NO5S — CID 57059925
(2,5-dihydroxypyrrol-1-yl) 3-ethoxy-2-sulfanylbutanoate (PubChem CID 57059925) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 3-ethoxy-2-sulfanylbutanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 3-ethoxy-2-sulfanylbutanoate |
|---|---|
| PubChem CID | 57059925 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 3-ethoxy-2-sulfanylbutanoate |
| SMILES | CCOC(C)C(S)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C10H15NO5S/c1-3-15-6(2)9(17)10(14)16-11-7(12)4-5-8(11)13/h4-6,9,12-13,17H,3H2,1-2H3 |
| InChIKey | YCROFPFYSUWFBK-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|