C15H18N2O10 — CID 54220759
(2,5-dihydroxypyrrol-1-yl) 5-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxypentyl carbonate (PubChem CID 54220759) has the molecular formula C15H18N2O10 and a molecular weight of 386.31 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 5-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxypentyl carbonate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 5-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxypentyl carbonate |
|---|---|
| PubChem CID | 54220759 |
| Molecular Formula | C15H18N2O10 |
| Molecular Weight | 386.31 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 5-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxypentyl carbonate |
| SMILES | O=C(OCCCCCOC(=O)On1c(O)ccc1O)On1c(O)ccc1O |
| InChI | InChI=1S/C15H18N2O10/c18-10-4-5-11(19)16(10)26-14(22)24-8-2-1-3-9-25-15(23)27-17-12(20)6-7-13(17)21/h4-7,18-21H,1-3,8-9H2 |
| InChIKey | QCKMXMPUPDGVJL-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 161.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|