C15H25NO4S — CID 91565220
(2,5-dihydroxypyrrol-1-yl) 11-sulfanylundecanoate (PubChem CID 91565220) has the molecular formula C15H25NO4S and a molecular weight of 315.43 g/mol. Its IUPAC name is (2,5-dihydroxypyrrol-1-yl) 11-sulfanylundecanoate.
| Compound Name | (2,5-dihydroxypyrrol-1-yl) 11-sulfanylundecanoate |
|---|---|
| PubChem CID | 91565220 |
| Molecular Formula | C15H25NO4S |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | (2,5-dihydroxypyrrol-1-yl) 11-sulfanylundecanoate |
| SMILES | O=C(CCCCCCCCCCS)On1c(O)ccc1O |
| InChI | InChI=1S/C15H25NO4S/c17-13-10-11-14(18)16(13)20-15(19)9-7-5-3-1-2-4-6-8-12-21/h10-11,17-18,21H,1-9,12H2 |
| InChIKey | ZNNZBUBSNLPTLD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|