C13H12N2O6 — CID 90975778
[4-(2-aminoacetyl)phenyl] (2,5-dihydroxypyrrol-1-yl) carbonate (PubChem CID 90975778) has the molecular formula C13H12N2O6 and a molecular weight of 292.25 g/mol. Its IUPAC name is [4-(2-aminoacetyl)phenyl] (2,5-dihydroxypyrrol-1-yl) carbonate.
| Compound Name | [4-(2-aminoacetyl)phenyl] (2,5-dihydroxypyrrol-1-yl) carbonate |
|---|---|
| PubChem CID | 90975778 |
| Molecular Formula | C13H12N2O6 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | [4-(2-aminoacetyl)phenyl] (2,5-dihydroxypyrrol-1-yl) carbonate |
| SMILES | NCC(=O)c1ccc(OC(=O)On2c(O)ccc2O)cc1 |
| InChI | InChI=1S/C13H12N2O6/c14-7-10(16)8-1-3-9(4-2-8)20-13(19)21-15-11(17)5-6-12(15)18/h1-6,17-18H,7,14H2 |
| InChIKey | MZLQCZUWVUABLC-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|