C26H32N2O16 — CID 123479617
bis(2,5-dihydroxypyrrol-1-yl) 2,3,4,5-tetra(propanoyloxy)hexanedioate (PubChem CID 123479617) has the molecular formula C26H32N2O16 and a molecular weight of 628.54 g/mol. Its IUPAC name is bis(2,5-dihydroxypyrrol-1-yl) 2,3,4,5-tetra(propanoyloxy)hexanedioate.
| Compound Name | bis(2,5-dihydroxypyrrol-1-yl) 2,3,4,5-tetra(propanoyloxy)hexanedioate |
|---|---|
| PubChem CID | 123479617 |
| Molecular Formula | C26H32N2O16 |
| Molecular Weight | 628.54 g/mol |
| Exact Mass | 628.18 |
| IUPAC Name | bis(2,5-dihydroxypyrrol-1-yl) 2,3,4,5-tetra(propanoyloxy)hexanedioate |
| SMILES | CCC(=O)OC(C(=O)On1c(O)ccc1O)C(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C(=O)On1c(O)ccc1O |
| InChI | InChI=1S/C26H32N2O16/c1-5-17(33)39-21(23(41-19(35)7-3)25(37)43-27-13(29)9-10-14(27)30)22(40-18(34)6-2)24(42-20(36)8-4)26(38)44-28-15(31)11-12-16(28)32/h9-12,21-24,29-32H,5-8H2,1-4H3 |
| InChIKey | QUAYNCKNXDRKEK-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 248.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.54 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|