C23H37NO13 — CID 58435468
2-methoxyethyl 6-(2-hydroxyethylamino)-6-oxo-2,3,4,5-tetra(propanoyloxy)hexanoate (PubChem CID 58435468) has the molecular formula C23H37NO13 and a molecular weight of 535.54 g/mol. Its IUPAC name is 2-methoxyethyl 6-(2-hydroxyethylamino)-6-oxo-2,3,4,5-tetra(propanoyloxy)hexanoate.
| Compound Name | 2-methoxyethyl 6-(2-hydroxyethylamino)-6-oxo-2,3,4,5-tetra(propanoyloxy)hexanoate |
|---|---|
| PubChem CID | 58435468 |
| Molecular Formula | C23H37NO13 |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | 2-methoxyethyl 6-(2-hydroxyethylamino)-6-oxo-2,3,4,5-tetra(propanoyloxy)hexanoate |
| SMILES | CCC(=O)OC(C(=O)NCCO)C(OC(=O)CC)C(OC(=O)CC)C(OC(=O)CC)C(=O)OCCOC |
| InChI | InChI=1S/C23H37NO13/c1-6-14(26)34-18(20(36-16(28)8-3)22(30)24-10-11-25)19(35-15(27)7-2)21(37-17(29)9-4)23(31)33-13-12-32-5/h18-21,25H,6-13H2,1-5H3,(H,24,30) |
| InChIKey | VYMJWTZGWJASHL-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 190.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|