C19H30O9 — CID 154935667
[(Z,2R,3R,4R)-1-hydroxy-3,4,5-tri(propanoyloxy)hept-5-en-2-yl] propanoate (PubChem CID 154935667) has the molecular formula C19H30O9 and a molecular weight of 402.44 g/mol. Its IUPAC name is [(Z,2R,3R,4R)-1-hydroxy-3,4,5-tri(propanoyloxy)hept-5-en-2-yl] propanoate.
| Compound Name | [(Z,2R,3R,4R)-1-hydroxy-3,4,5-tri(propanoyloxy)hept-5-en-2-yl] propanoate |
|---|---|
| PubChem CID | 154935667 |
| Molecular Formula | C19H30O9 |
| Molecular Weight | 402.44 g/mol |
| Exact Mass | 402.19 |
| IUPAC Name | [(Z,2R,3R,4R)-1-hydroxy-3,4,5-tri(propanoyloxy)hept-5-en-2-yl] propanoate |
| SMILES | C/C=C(\OC(=O)CC)[C@H](OC(=O)CC)[C@H](OC(=O)CC)[C@@H](CO)OC(=O)CC |
| InChI | InChI=1S/C19H30O9/c1-6-12(25-14(21)7-2)18(27-16(23)9-4)19(28-17(24)10-5)13(11-20)26-15(22)8-3/h6,13,18-20H,7-11H2,1-5H3/b12-6-/t13-,18+,19-/m1/s1 |
| InChIKey | WSSFMMYVWSDXIC-SWAZGABGSA-N |
| XLogP | 1.80 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.44 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|