C11H19NO5 — CID 147402062
[(2S,3S)-4-hydroxy-1-(methylideneamino)-3-propanoyloxybutan-2-yl] propanoate (PubChem CID 147402062) has the molecular formula C11H19NO5 and a molecular weight of 245.27 g/mol. Its IUPAC name is [(2S,3S)-4-hydroxy-1-(methylideneamino)-3-propanoyloxybutan-2-yl] propanoate.
| Compound Name | [(2S,3S)-4-hydroxy-1-(methylideneamino)-3-propanoyloxybutan-2-yl] propanoate |
|---|---|
| PubChem CID | 147402062 |
| Molecular Formula | C11H19NO5 |
| Molecular Weight | 245.27 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | [(2S,3S)-4-hydroxy-1-(methylideneamino)-3-propanoyloxybutan-2-yl] propanoate |
| SMILES | C=NC[C@H](OC(=O)CC)[C@H](CO)OC(=O)CC |
| InChI | InChI=1S/C11H19NO5/c1-4-10(14)16-8(6-12-3)9(7-13)17-11(15)5-2/h8-9,13H,3-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | DOYIUAIQQNZGPF-IUCAKERBSA-N |
| XLogP | 0.32 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.27 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|