About 2,4-dimethylpentan-3-yl propanoate;methane
2,4-dimethylpentan-3-yl propanoate;methane (PubChem CID 167541618) has the molecular formula C11H24O2
and a molecular weight of 188.31 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl propanoate;methane.
Molecular Properties
| Compound Name | 2,4-dimethylpentan-3-yl propanoate;methane |
| PubChem CID | 167541618 |
| Molecular Formula | C11H24O2 |
| Molecular Weight | 188.31 g/mol |
| Exact Mass | 188.18 |
| IUPAC Name | 2,4-dimethylpentan-3-yl propanoate;methane |
| SMILES | C.CCC(=O)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C10H20O2.CH4/c1-6-9(11)12-10(7(2)3)8(4)5;/h7-8,10H,6H2,1-5H3;1H4 |
| InChIKey | BGPJTYXBTUDUSL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dimethylpentan-3-yl propanoate;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpentan-3-yl propanoate;methane?
The IUPAC name of 2,4-dimethylpentan-3-yl propanoate;methane (CID 167541618) is 2,4-dimethylpentan-3-yl propanoate;methane.
What is the SMILES notation for 2,4-dimethylpentan-3-yl propanoate;methane?
The canonical SMILES for 2,4-dimethylpentan-3-yl propanoate;methane is C.CCC(=O)OC(C(C)C)C(C)C.
What is the InChIKey of 2,4-dimethylpentan-3-yl propanoate;methane?
The InChIKey is BGPJTYXBTUDUSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O2.CH4/c1-6-9(11)12-10(7(2)3)8(4)5;/h7-8,10H,6H2,1-5H3;1H4.
What are the key properties of 2,4-dimethylpentan-3-yl propanoate;methane?
2,4-dimethylpentan-3-yl propanoate;methane has a molecular weight of 188.31 g/mol, XLogP of 3.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpentan-3-yl propanoate;methane is sourced from PubChem (CID 167541618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).