About propan-2-one;propan-2-yl propanoate
propan-2-one;propan-2-yl propanoate (PubChem CID 161266557) has the molecular formula C9H18O3
and a molecular weight of 174.24 g/mol. Its IUPAC name is propan-2-one;propan-2-yl propanoate.
Molecular Properties
| Compound Name | propan-2-one;propan-2-yl propanoate |
| PubChem CID | 161266557 |
| Molecular Formula | C9H18O3 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.13 |
| IUPAC Name | propan-2-one;propan-2-yl propanoate |
| SMILES | CC(C)=O.CCC(=O)OC(C)C |
| InChI | InChI=1S/C6H12O2.C3H6O/c1-4-6(7)8-5(2)3;1-3(2)4/h5H,4H2,1-3H3;1-2H3 |
| InChIKey | VDGLSFJDSWHJFI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze propan-2-one;propan-2-yl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-one;propan-2-yl propanoate?
The IUPAC name of propan-2-one;propan-2-yl propanoate (CID 161266557) is propan-2-one;propan-2-yl propanoate.
What is the SMILES notation for propan-2-one;propan-2-yl propanoate?
The canonical SMILES for propan-2-one;propan-2-yl propanoate is CC(C)=O.CCC(=O)OC(C)C.
What is the InChIKey of propan-2-one;propan-2-yl propanoate?
The InChIKey is VDGLSFJDSWHJFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2.C3H6O/c1-4-6(7)8-5(2)3;1-3(2)4/h5H,4H2,1-3H3;1-2H3.
What are the key properties of propan-2-one;propan-2-yl propanoate?
propan-2-one;propan-2-yl propanoate has a molecular weight of 174.24 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-one;propan-2-yl propanoate is sourced from PubChem (CID 161266557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).