About methane;1-propanoyloxyethyl 2-methylpropanoate
methane;1-propanoyloxyethyl 2-methylpropanoate (PubChem CID 161244899) has the molecular formula C10H20O4
and a molecular weight of 204.27 g/mol. Its IUPAC name is methane;1-propanoyloxyethyl 2-methylpropanoate.
Molecular Properties
| Compound Name | methane;1-propanoyloxyethyl 2-methylpropanoate |
| PubChem CID | 161244899 |
| Molecular Formula | C10H20O4 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | methane;1-propanoyloxyethyl 2-methylpropanoate |
| SMILES | C.CCC(=O)OC(C)OC(=O)C(C)C |
| InChI | InChI=1S/C9H16O4.CH4/c1-5-8(10)12-7(4)13-9(11)6(2)3;/h6-7H,5H2,1-4H3;1H4 |
| InChIKey | VAMUORAAAKPWBV-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze methane;1-propanoyloxyethyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-propanoyloxyethyl 2-methylpropanoate?
The IUPAC name of methane;1-propanoyloxyethyl 2-methylpropanoate (CID 161244899) is methane;1-propanoyloxyethyl 2-methylpropanoate.
What is the SMILES notation for methane;1-propanoyloxyethyl 2-methylpropanoate?
The canonical SMILES for methane;1-propanoyloxyethyl 2-methylpropanoate is C.CCC(=O)OC(C)OC(=O)C(C)C.
What is the InChIKey of methane;1-propanoyloxyethyl 2-methylpropanoate?
The InChIKey is VAMUORAAAKPWBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O4.CH4/c1-5-8(10)12-7(4)13-9(11)6(2)3;/h6-7H,5H2,1-4H3;1H4.
What are the key properties of methane;1-propanoyloxyethyl 2-methylpropanoate?
methane;1-propanoyloxyethyl 2-methylpropanoate has a molecular weight of 204.27 g/mol, XLogP of 2.12, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-propanoyloxyethyl 2-methylpropanoate is sourced from PubChem (CID 161244899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).