C15H28O2 — CID 140637119
2,4-dimethylpentan-3-yl (E)-oct-5-enoate (PubChem CID 140637119) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl (E)-oct-5-enoate.
| Compound Name | 2,4-dimethylpentan-3-yl (E)-oct-5-enoate |
|---|---|
| PubChem CID | 140637119 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 2,4-dimethylpentan-3-yl (E)-oct-5-enoate |
| SMILES | CC/C=C/CCCC(=O)OC(C(C)C)C(C)C |
| InChI | InChI=1S/C15H28O2/c1-6-7-8-9-10-11-14(16)17-15(12(2)3)13(4)5/h7-8,12-13,15H,6,9-11H2,1-5H3/b8-7+ |
| InChIKey | DMVYVKYNEYMEIM-BQYQJAHWSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|