C10H17N3O5 — CID 58083796
[(2S,3S)-1-azido-4-hydroxy-3-propanoyloxybutan-2-yl] propanoate (PubChem CID 58083796) has the molecular formula C10H17N3O5 and a molecular weight of 259.26 g/mol. Its IUPAC name is [(2S,3S)-1-azido-4-hydroxy-3-propanoyloxybutan-2-yl] propanoate.
| Compound Name | [(2S,3S)-1-azido-4-hydroxy-3-propanoyloxybutan-2-yl] propanoate |
|---|---|
| PubChem CID | 58083796 |
| Molecular Formula | C10H17N3O5 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | [(2S,3S)-1-azido-4-hydroxy-3-propanoyloxybutan-2-yl] propanoate |
| SMILES | CCC(=O)O[C@@H](CO)[C@H](CN=[N+]=[N-])OC(=O)CC |
| InChI | InChI=1S/C10H17N3O5/c1-3-9(15)17-7(5-12-13-11)8(6-14)18-10(16)4-2/h7-8,14H,3-6H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | DYWSJGFGBIYNRF-YUMQZZPRSA-N |
| XLogP | 0.93 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|