C8H15N3O4 — CID 23392928
7-azido-4,5-dihydroxy-6-methoxyheptan-3-one (PubChem CID 23392928) has the molecular formula C8H15N3O4 and a molecular weight of 217.22 g/mol. Its IUPAC name is 7-azido-4,5-dihydroxy-6-methoxyheptan-3-one.
| Compound Name | 7-azido-4,5-dihydroxy-6-methoxyheptan-3-one |
|---|---|
| PubChem CID | 23392928 |
| Molecular Formula | C8H15N3O4 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 7-azido-4,5-dihydroxy-6-methoxyheptan-3-one |
| SMILES | CCC(=O)C(O)C(O)C(CN=[N+]=[N-])OC |
| InChI | InChI=1S/C8H15N3O4/c1-3-5(12)7(13)8(14)6(15-2)4-10-11-9/h6-8,13-14H,3-4H2,1-2H3 |
| InChIKey | VURHGOGUMZFNKM-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|