C9H17N3O6 — CID 101153114
(2R,3S,4S,5R)-6-azido-5-hydroxy-2,3,4-trimethoxyhexanoic acid (PubChem CID 101153114) has the molecular formula C9H17N3O6 and a molecular weight of 263.25 g/mol. Its IUPAC name is (2R,3S,4S,5R)-6-azido-5-hydroxy-2,3,4-trimethoxyhexanoic acid.
| Compound Name | (2R,3S,4S,5R)-6-azido-5-hydroxy-2,3,4-trimethoxyhexanoic acid |
|---|---|
| PubChem CID | 101153114 |
| Molecular Formula | C9H17N3O6 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | (2R,3S,4S,5R)-6-azido-5-hydroxy-2,3,4-trimethoxyhexanoic acid |
| SMILES | CO[C@H]([C@H](OC)[C@@H](OC)C(=O)O)[C@H](O)CN=[N+]=[N-] |
| InChI | InChI=1S/C9H17N3O6/c1-16-6(5(13)4-11-12-10)7(17-2)8(18-3)9(14)15/h5-8,13H,4H2,1-3H3,(H,14,15)/t5-,6+,7+,8-/m1/s1 |
| InChIKey | AZDGVKKOHZWETR-VGRMVHKJSA-N |
| XLogP | -0.21 |
| TPSA | 133.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|