C12H19N5O6 — CID 175168067
[(2R,3S,4S,5R)-2,4-diacetamido-6-azido-5-hydroxy-1-oxohexan-3-yl] acetate (PubChem CID 175168067) has the molecular formula C12H19N5O6 and a molecular weight of 329.31 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-2,4-diacetamido-6-azido-5-hydroxy-1-oxohexan-3-yl] acetate.
| Compound Name | [(2R,3S,4S,5R)-2,4-diacetamido-6-azido-5-hydroxy-1-oxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 175168067 |
| Molecular Formula | C12H19N5O6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | [(2R,3S,4S,5R)-2,4-diacetamido-6-azido-5-hydroxy-1-oxohexan-3-yl] acetate |
| SMILES | CC(=O)N[C@H]([C@H](OC(C)=O)[C@H](C=O)NC(C)=O)[C@H](O)CN=[N+]=[N-] |
| InChI | InChI=1S/C12H19N5O6/c1-6(19)15-9(5-18)12(23-8(3)21)11(16-7(2)20)10(22)4-14-17-13/h5,9-12,22H,4H2,1-3H3,(H,15,19)(H,16,20)/t9-,10+,11-,12+/m0/s1 |
| InChIKey | YQGOCEFWMGRRNP-WHOHXGKFSA-N |
| XLogP | -1.20 |
| TPSA | 170.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|