C10H17NO6 — CID 101228585
[(2R,3R,4R,5R)-4-acetamido-2,5-dihydroxy-6-oxohexan-3-yl] acetate (PubChem CID 101228585) has the molecular formula C10H17NO6 and a molecular weight of 247.25 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetamido-2,5-dihydroxy-6-oxohexan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-4-acetamido-2,5-dihydroxy-6-oxohexan-3-yl] acetate |
|---|---|
| PubChem CID | 101228585 |
| Molecular Formula | C10H17NO6 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetamido-2,5-dihydroxy-6-oxohexan-3-yl] acetate |
| SMILES | CC(=O)N[C@@H]([C@@H](OC(C)=O)[C@@H](C)O)[C@@H](O)C=O |
| InChI | InChI=1S/C10H17NO6/c1-5(13)10(17-7(3)15)9(8(16)4-12)11-6(2)14/h4-5,8-10,13,16H,1-3H3,(H,11,14)/t5-,8+,9-,10+/m1/s1 |
| InChIKey | SSEZDXQPWMFYEY-NZENMJELSA-N |
| XLogP | -1.64 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|