C7H12O5 — CID 141317796
[(2R,3R,4R)-3,4-dihydroxy-1-oxopentan-2-yl] acetate (PubChem CID 141317796) has the molecular formula C7H12O5 and a molecular weight of 176.17 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-dihydroxy-1-oxopentan-2-yl] acetate.
| Compound Name | [(2R,3R,4R)-3,4-dihydroxy-1-oxopentan-2-yl] acetate |
|---|---|
| PubChem CID | 141317796 |
| Molecular Formula | C7H12O5 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | [(2R,3R,4R)-3,4-dihydroxy-1-oxopentan-2-yl] acetate |
| SMILES | CC(=O)O[C@@H](C=O)[C@H](O)[C@@H](C)O |
| InChI | InChI=1S/C7H12O5/c1-4(9)7(11)6(3-8)12-5(2)10/h3-4,6-7,9,11H,1-2H3/t4-,6+,7-/m1/s1 |
| InChIKey | YODUHSKMMKBYKQ-PRMYIZFSSA-N |
| XLogP | -1.14 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|