C14H18F2O9 — CID 87333983
[(2R,3S,4R,5S)-3,4,5-triacetyloxy-6,6-difluoro-1-oxohexan-2-yl] acetate (PubChem CID 87333983) has the molecular formula C14H18F2O9 and a molecular weight of 368.29 g/mol. Its IUPAC name is [(2R,3S,4R,5S)-3,4,5-triacetyloxy-6,6-difluoro-1-oxohexan-2-yl] acetate.
| Compound Name | [(2R,3S,4R,5S)-3,4,5-triacetyloxy-6,6-difluoro-1-oxohexan-2-yl] acetate |
|---|---|
| PubChem CID | 87333983 |
| Molecular Formula | C14H18F2O9 |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | [(2R,3S,4R,5S)-3,4,5-triacetyloxy-6,6-difluoro-1-oxohexan-2-yl] acetate |
| SMILES | CC(=O)O[C@H]([C@H](OC(C)=O)[C@H](C=O)OC(C)=O)[C@H](OC(C)=O)C(F)F |
| InChI | InChI=1S/C14H18F2O9/c1-6(18)22-10(5-17)11(23-7(2)19)12(24-8(3)20)13(14(15)16)25-9(4)21/h5,10-14H,1-4H3/t10-,11+,12+,13-/m0/s1 |
| InChIKey | BDOBCKKZBCTEMM-LOWDOPEQSA-N |
| XLogP | 0.18 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|