C16H21NO9 — CID 87127134
[(4R,5R,6S)-4,5,6-triacetyloxy-1-cyano-7-oxoheptan-3-yl] acetate (PubChem CID 87127134) has the molecular formula C16H21NO9 and a molecular weight of 371.34 g/mol. Its IUPAC name is [(4R,5R,6S)-4,5,6-triacetyloxy-1-cyano-7-oxoheptan-3-yl] acetate.
| Compound Name | [(4R,5R,6S)-4,5,6-triacetyloxy-1-cyano-7-oxoheptan-3-yl] acetate |
|---|---|
| PubChem CID | 87127134 |
| Molecular Formula | C16H21NO9 |
| Molecular Weight | 371.34 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [(4R,5R,6S)-4,5,6-triacetyloxy-1-cyano-7-oxoheptan-3-yl] acetate |
| SMILES | CC(=O)OC(CCC#N)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](C=O)OC(C)=O |
| InChI | InChI=1S/C16H21NO9/c1-9(19)23-13(6-5-7-17)15(25-11(3)21)16(26-12(4)22)14(8-18)24-10(2)20/h8,13-16H,5-6H2,1-4H3/t13?,14-,15-,16+/m1/s1 |
| InChIKey | HRTGGYGNTLADKU-VIYLOZMYSA-N |
| XLogP | 0.22 |
| TPSA | 146.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.34 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|