C10H16O8 — CID 173208423
[(2S,3R,4R)-3-acetyloxy-4,5-dihydroxy-1-oxopentan-2-yl] 2-hydroxypropanoate (PubChem CID 173208423) has the molecular formula C10H16O8 and a molecular weight of 264.23 g/mol. Its IUPAC name is [(2S,3R,4R)-3-acetyloxy-4,5-dihydroxy-1-oxopentan-2-yl] 2-hydroxypropanoate.
| Compound Name | [(2S,3R,4R)-3-acetyloxy-4,5-dihydroxy-1-oxopentan-2-yl] 2-hydroxypropanoate |
|---|---|
| PubChem CID | 173208423 |
| Molecular Formula | C10H16O8 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | [(2S,3R,4R)-3-acetyloxy-4,5-dihydroxy-1-oxopentan-2-yl] 2-hydroxypropanoate |
| SMILES | CC(=O)O[C@H]([C@H](O)CO)[C@@H](C=O)OC(=O)C(C)O |
| InChI | InChI=1S/C10H16O8/c1-5(13)10(16)18-8(4-12)9(7(15)3-11)17-6(2)14/h4-5,7-9,11,13,15H,3H2,1-2H3/t5?,7-,8-,9-/m1/s1 |
| InChIKey | LGJUNIWJTVOYIJ-BSUQUYKDSA-N |
| XLogP | -2.24 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|