C7H11BrO5 — CID 174455651
(3-bromo-4,5-dihydroxy-1-oxopentan-2-yl) acetate (PubChem CID 174455651) has the molecular formula C7H11BrO5 and a molecular weight of 255.06 g/mol. Its IUPAC name is (3-bromo-4,5-dihydroxy-1-oxopentan-2-yl) acetate.
| Compound Name | (3-bromo-4,5-dihydroxy-1-oxopentan-2-yl) acetate |
|---|---|
| PubChem CID | 174455651 |
| Molecular Formula | C7H11BrO5 |
| Molecular Weight | 255.06 g/mol |
| Exact Mass | 253.98 |
| IUPAC Name | (3-bromo-4,5-dihydroxy-1-oxopentan-2-yl) acetate |
| SMILES | CC(=O)OC(C=O)C(Br)C(O)CO |
| InChI | InChI=1S/C7H11BrO5/c1-4(11)13-6(3-10)7(8)5(12)2-9/h3,5-7,9,12H,2H2,1H3 |
| InChIKey | QMXCVMNTCFYGDA-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.06 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|