C9H14O6 — CID 87644621
[(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] 2-methylprop-2-enoate (PubChem CID 87644621) has the molecular formula C9H14O6 and a molecular weight of 218.20 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87644621 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | [(2R,3R,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[C@@H](C=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C9H14O6/c1-5(2)9(14)15-7(4-11)8(13)6(12)3-10/h4,6-8,10,12-13H,1,3H2,2H3/t6-,7+,8-/m1/s1 |
| InChIKey | RBZQFGIEAFVLBW-GJMOJQLCSA-N |
| XLogP | -1.61 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|