C15H28O6 — CID 54323669
[(2R,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] decanoate (PubChem CID 54323669) has the molecular formula C15H28O6 and a molecular weight of 304.38 g/mol. Its IUPAC name is [(2R,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] decanoate.
| Compound Name | [(2R,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] decanoate |
|---|---|
| PubChem CID | 54323669 |
| Molecular Formula | C15H28O6 |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | [(2R,3S,4R)-3,4,5-trihydroxy-1-oxopentan-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@@H](C=O)[C@@H](O)[C@H](O)CO |
| InChI | InChI=1S/C15H28O6/c1-2-3-4-5-6-7-8-9-14(19)21-13(11-17)15(20)12(18)10-16/h11-13,15-16,18,20H,2-10H2,1H3/t12-,13+,15+/m1/s1 |
| InChIKey | STKJNUJQANSXKS-IPYPFGDCSA-N |
| XLogP | 0.95 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|