C30H54O9 — CID 54080902
[(2R,3S,4S,5R)-5,6-dihydroxy-3,4-di(octanoyloxy)-1-oxohexan-2-yl] octanoate (PubChem CID 54080902) has the molecular formula C30H54O9 and a molecular weight of 558.75 g/mol. Its IUPAC name is [(2R,3S,4S,5R)-5,6-dihydroxy-3,4-di(octanoyloxy)-1-oxohexan-2-yl] octanoate.
| Compound Name | [(2R,3S,4S,5R)-5,6-dihydroxy-3,4-di(octanoyloxy)-1-oxohexan-2-yl] octanoate |
|---|---|
| PubChem CID | 54080902 |
| Molecular Formula | C30H54O9 |
| Molecular Weight | 558.75 g/mol |
| Exact Mass | 558.38 |
| IUPAC Name | [(2R,3S,4S,5R)-5,6-dihydroxy-3,4-di(octanoyloxy)-1-oxohexan-2-yl] octanoate |
| SMILES | CCCCCCCC(=O)O[C@H]([C@H](OC(=O)CCCCCCC)[C@H](C=O)OC(=O)CCCCCCC)[C@H](O)CO |
| InChI | InChI=1S/C30H54O9/c1-4-7-10-13-16-19-26(34)37-25(23-32)30(39-28(36)21-18-15-12-9-6-3)29(24(33)22-31)38-27(35)20-17-14-11-8-5-2/h23-25,29-31,33H,4-22H2,1-3H3/t24-,25+,29+,30-/m1/s1 |
| InChIKey | MNAREMGKNRSCRH-VMGOQZOXSA-N |
| XLogP | 5.36 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.75 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|