C77H138O9 — CID 151266234
[(2R,3S,4R)-2,3,4-tris[[(Z)-octadec-9-enoyl]oxy]-5-oxopentyl] (Z)-octadec-9-enoate (PubChem CID 151266234) has the molecular formula C77H138O9 and a molecular weight of 1207.94 g/mol. Its IUPAC name is [(2R,3S,4R)-2,3,4-tris[[(Z)-octadec-9-enoyl]oxy]-5-oxopentyl] (Z)-octadec-9-enoate.
| Compound Name | [(2R,3S,4R)-2,3,4-tris[[(Z)-octadec-9-enoyl]oxy]-5-oxopentyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 151266234 |
| Molecular Formula | C77H138O9 |
| Molecular Weight | 1207.94 g/mol |
| Exact Mass | 1207.03 |
| IUPAC Name | [(2R,3S,4R)-2,3,4-tris[[(Z)-octadec-9-enoyl]oxy]-5-oxopentyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OC[C@@H](OC(=O)CCCCCCC/C=C\CCCCCCCC)[C@H](OC(=O)CCCCCCC/C=C\CCCCCCCC)[C@H](C=O)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C77H138O9/c1-5-9-13-17-21-25-29-33-37-41-45-49-53-57-61-65-73(79)83-70-72(85-75(81)67-63-59-55-51-47-43-39-35-31-27-23-19-15-11-7-3)77(86-76(82)68-64-60-56-52-48-44-40-36-32-28-24-20-16-12-8-4)71(69-78)84-74(80)66-62-58-54-50-46-42-38-34-30-26-22-18-14-10-6-2/h33-40,69,71-72,77H,5-32,41-68,70H2,1-4H3/b37-33-,38-34-,39-35-,40-36-/t71-,72+,77+/m0/s1 |
| InChIKey | NVKDPNVXZUWKSV-YWKASHTKSA-N |
| XLogP | 23.61 |
| TPSA | 122.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 68 |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1207.94 |
| LogP ≤ 5 | 23.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|