C96H174O11 — CID 156628184
[6-hydroxy-2,3,4,5-tetrakis[[(E)-octadec-9-enoyl]oxy]hexyl] (E)-octadec-9-enoate (PubChem CID 156628184) has the molecular formula C96H174O11 and a molecular weight of 1504.44 g/mol. Its IUPAC name is [6-hydroxy-2,3,4,5-tetrakis[[(E)-octadec-9-enoyl]oxy]hexyl] (E)-octadec-9-enoate.
| Compound Name | [6-hydroxy-2,3,4,5-tetrakis[[(E)-octadec-9-enoyl]oxy]hexyl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 156628184 |
| Molecular Formula | C96H174O11 |
| Molecular Weight | 1504.44 g/mol |
| Exact Mass | 1503.31 |
| IUPAC Name | [6-hydroxy-2,3,4,5-tetrakis[[(E)-octadec-9-enoyl]oxy]hexyl] (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OCC(OC(=O)CCCCCCC/C=C/CCCCCCCC)C(OC(=O)CCCCCCC/C=C/CCCCCCCC)C(OC(=O)CCCCCCC/C=C/CCCCCCCC)C(CO)OC(=O)CCCCCCC/C=C/CCCCCCCC |
| InChI | InChI=1S/C96H174O11/c1-6-11-16-21-26-31-36-41-46-51-56-61-66-71-76-81-90(98)103-87-89(105-92(100)83-78-73-68-63-58-53-48-43-38-33-28-23-18-13-8-3)96(107-94(102)85-80-75-70-65-60-55-50-45-40-35-30-25-20-15-10-5)95(106-93(101)84-79-74-69-64-59-54-49-44-39-34-29-24-19-14-9-4)88(86-97)104-91(99)82-77-72-67-62-57-52-47-42-37-32-27-22-17-12-7-2/h41-50,88-89,95-97H,6-40,51-87H2,1-5H3/b46-41+,47-42+,48-43+,49-44+,50-45+ |
| InChIKey | XZLUHRWHHWROEQ-SNBIMISBSA-N |
| XLogP | 29.36 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 85 |
| Heavy Atoms | 107 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1504.44 |
| LogP ≤ 5 | 29.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|