C12H20O8 — CID 87698385
[(2R,3S,4R,5R)-3-acetyloxy-4,5,6-trihydroxy-1-oxohexan-2-yl] butanoate (PubChem CID 87698385) has the molecular formula C12H20O8 and a molecular weight of 292.28 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-3-acetyloxy-4,5,6-trihydroxy-1-oxohexan-2-yl] butanoate.
| Compound Name | [(2R,3S,4R,5R)-3-acetyloxy-4,5,6-trihydroxy-1-oxohexan-2-yl] butanoate |
|---|---|
| PubChem CID | 87698385 |
| Molecular Formula | C12H20O8 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | [(2R,3S,4R,5R)-3-acetyloxy-4,5,6-trihydroxy-1-oxohexan-2-yl] butanoate |
| SMILES | CCCC(=O)O[C@@H](C=O)[C@@H](OC(C)=O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H20O8/c1-3-4-10(17)20-9(6-14)12(19-7(2)15)11(18)8(16)5-13/h6,8-9,11-13,16,18H,3-5H2,1-2H3/t8-,9+,11-,12-/m1/s1 |
| InChIKey | CMNUZXVFMMRVLF-RBLKWDMZSA-N |
| XLogP | -1.46 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|