C17H28O11 — CID 87759927
propan-1-ol;[(2R,3R,4S,5R)-3,4,5-triacetyloxy-2-hydroxy-6-oxohexyl] acetate (PubChem CID 87759927) has the molecular formula C17H28O11 and a molecular weight of 408.40 g/mol. Its IUPAC name is propan-1-ol;[(2R,3R,4S,5R)-3,4,5-triacetyloxy-2-hydroxy-6-oxohexyl] acetate.
| Compound Name | propan-1-ol;[(2R,3R,4S,5R)-3,4,5-triacetyloxy-2-hydroxy-6-oxohexyl] acetate |
|---|---|
| PubChem CID | 87759927 |
| Molecular Formula | C17H28O11 |
| Molecular Weight | 408.40 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | propan-1-ol;[(2R,3R,4S,5R)-3,4,5-triacetyloxy-2-hydroxy-6-oxohexyl] acetate |
| SMILES | CC(=O)OC[C@@H](O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](C=O)OC(C)=O.CCCO |
| InChI | InChI=1S/C14H20O10.C3H8O/c1-7(16)21-6-11(20)13(23-9(3)18)14(24-10(4)19)12(5-15)22-8(2)17;1-2-3-4/h5,11-14,20H,6H2,1-4H3;4H,2-3H2,1H3/t11-,12+,13-,14-;/m1./s1 |
| InChIKey | MGKDTKOIYIOGMI-TWPGKBSFSA-N |
| XLogP | -0.71 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.40 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|