C22H36O10 — CID 101130412
[(2S,3S,4R,5S)-2-hydroxy-3,4,5-tris(2-methylpropanoyloxy)-6-oxohexyl] 2-methylpropanoate (PubChem CID 101130412) has the molecular formula C22H36O10 and a molecular weight of 460.52 g/mol. Its IUPAC name is [(2S,3S,4R,5S)-2-hydroxy-3,4,5-tris(2-methylpropanoyloxy)-6-oxohexyl] 2-methylpropanoate.
| Compound Name | [(2S,3S,4R,5S)-2-hydroxy-3,4,5-tris(2-methylpropanoyloxy)-6-oxohexyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 101130412 |
| Molecular Formula | C22H36O10 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.23 |
| IUPAC Name | [(2S,3S,4R,5S)-2-hydroxy-3,4,5-tris(2-methylpropanoyloxy)-6-oxohexyl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC[C@H](O)[C@H](OC(=O)C(C)C)[C@@H](OC(=O)C(C)C)[C@@H](C=O)OC(=O)C(C)C |
| InChI | InChI=1S/C22H36O10/c1-11(2)19(25)29-10-15(24)17(31-21(27)13(5)6)18(32-22(28)14(7)8)16(9-23)30-20(26)12(3)4/h9,11-18,24H,10H2,1-8H3/t15-,16+,17-,18-/m0/s1 |
| InChIKey | RTFDTKCJNQTZFU-MHORFTMASA-N |
| XLogP | 1.45 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|