C13H26O5 — CID 88926790
[(2R,3R,4S,5R)-2,4,5-trihydroxy-6,6-dimethylheptan-3-yl] 2-methylpropanoate (PubChem CID 88926790) has the molecular formula C13H26O5 and a molecular weight of 262.35 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2,4,5-trihydroxy-6,6-dimethylheptan-3-yl] 2-methylpropanoate.
| Compound Name | [(2R,3R,4S,5R)-2,4,5-trihydroxy-6,6-dimethylheptan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 88926790 |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | [(2R,3R,4S,5R)-2,4,5-trihydroxy-6,6-dimethylheptan-3-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)O[C@@H]([C@@H](O)[C@H](O)C(C)(C)C)[C@@H](C)O |
| InChI | InChI=1S/C13H26O5/c1-7(2)12(17)18-10(8(3)14)9(15)11(16)13(4,5)6/h7-11,14-16H,1-6H3/t8-,9-,10-,11+/m1/s1 |
| InChIKey | DEJQYEMSCGYNGE-DBIOUOCHSA-N |
| XLogP | 0.70 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |