C11H24O3 — CID 18916262
2,2,6,6-tetramethylheptane-3,4,5-triol (PubChem CID 18916262) has the molecular formula C11H24O3 and a molecular weight of 204.31 g/mol. Its IUPAC name is 2,2,6,6-tetramethylheptane-3,4,5-triol.
| Compound Name | 2,2,6,6-tetramethylheptane-3,4,5-triol |
|---|---|
| PubChem CID | 18916262 |
| Molecular Formula | C11H24O3 |
| Molecular Weight | 204.31 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | 2,2,6,6-tetramethylheptane-3,4,5-triol |
| SMILES | CC(C)(C)C(O)C(O)C(O)C(C)(C)C |
| InChI | InChI=1S/C11H24O3/c1-10(2,3)8(13)7(12)9(14)11(4,5)6/h7-9,12-14H,1-6H3 |
| InChIKey | HDXAQJALAKVYTG-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |