C8H16O3 — CID 10909859
(2R,3R)-3-hydroxy-2,4,4-trimethylpentanoic acid (PubChem CID 10909859) has the molecular formula C8H16O3 and a molecular weight of 160.21 g/mol. Its IUPAC name is (2R,3R)-3-hydroxy-2,4,4-trimethylpentanoic acid.
| Compound Name | (2R,3R)-3-hydroxy-2,4,4-trimethylpentanoic acid |
|---|---|
| PubChem CID | 10909859 |
| Molecular Formula | C8H16O3 |
| Molecular Weight | 160.21 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | (2R,3R)-3-hydroxy-2,4,4-trimethylpentanoic acid |
| SMILES | C[C@@H](C(=O)O)[C@@H](O)C(C)(C)C |
| InChI | InChI=1S/C8H16O3/c1-5(7(10)11)6(9)8(2,3)4/h5-6,9H,1-4H3,(H,10,11)/t5-,6-/m1/s1 |
| InChIKey | SRACGGODXOHIBL-PHDIDXHHSA-N |
| XLogP | 1.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.21 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |