About (2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid
(2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid (PubChem CID 102001505) has the molecular formula C8H16O3S
and a molecular weight of 192.28 g/mol. Its IUPAC name is (2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid.
Analyze (2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid?
The IUPAC name of (2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid (CID 102001505) is (2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid.
What is the SMILES notation for (2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid?
The canonical SMILES for (2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid is CS[C@@H](C(=O)O)[C@H](O)C(C)(C)C.
What is the InChIKey of (2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid?
The InChIKey is GOMXBYGGYYXFEC-RITPCOANSA-N. The full InChI is InChI=1S/C8H16O3S/c1-8(2,3)6(9)5(12-4)7(10)11/h5-6,9H,1-4H3,(H,10,11)/t5-,6+/m1/s1.
What are the key properties of (2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid?
(2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid has a molecular weight of 192.28 g/mol, XLogP of 1.21, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3R)-3-hydroxy-4,4-dimethyl-2-methylsulfanylpentanoic acid is sourced from PubChem (CID 102001505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).