C5H6O5S-2 — CID 172675806
(2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate (PubChem CID 172675806) has the molecular formula C5H6O5S-2 and a molecular weight of 178.16 g/mol. Its IUPAC name is (2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate.
| Compound Name | (2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate |
|---|---|
| PubChem CID | 172675806 |
| Molecular Formula | C5H6O5S-2 |
| Molecular Weight | 178.16 g/mol |
| Exact Mass | 177.99 |
| IUPAC Name | (2S,3S)-2-hydroxy-3-methylsulfanylbutanedioate |
| SMILES | CS[C@H](C(=O)[O-])[C@@H](O)C(=O)[O-] |
| InChI | InChI=1S/C5H8O5S/c1-11-3(5(9)10)2(6)4(7)8/h2-3,6H,1H3,(H,7,8)(H,9,10)/p-2/t2-,3+/m1/s1 |
| InChIKey | PCJAJGVDQOJOMA-GBXIJSLDSA-L |
| XLogP | -3.42 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.16 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |