About azane;2-methylpropanoic acid;hydrate
azane;2-methylpropanoic acid;hydrate (PubChem CID 161320294) has the molecular formula C4H13NO3
and a molecular weight of 123.15 g/mol. Its IUPAC name is azane;2-methylpropanoic acid;hydrate.
Molecular Properties
| Compound Name | azane;2-methylpropanoic acid;hydrate |
| PubChem CID | 161320294 |
| Molecular Formula | C4H13NO3 |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.09 |
| IUPAC Name | azane;2-methylpropanoic acid;hydrate |
| SMILES | CC(C)C(=O)O.N.O |
| InChI | InChI=1S/C4H8O2.H3N.H2O/c1-3(2)4(5)6;;/h3H,1-2H3,(H,5,6);1H3;1H2 |
| InChIKey | UMFQPQLYSOSXSB-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;2-methylpropanoic acid;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;2-methylpropanoic acid;hydrate?
The IUPAC name of azane;2-methylpropanoic acid;hydrate (CID 161320294) is azane;2-methylpropanoic acid;hydrate.
What is the SMILES notation for azane;2-methylpropanoic acid;hydrate?
The canonical SMILES for azane;2-methylpropanoic acid;hydrate is CC(C)C(=O)O.N.O.
What is the InChIKey of azane;2-methylpropanoic acid;hydrate?
The InChIKey is UMFQPQLYSOSXSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.H3N.H2O/c1-3(2)4(5)6;;/h3H,1-2H3,(H,5,6);1H3;1H2.
What are the key properties of azane;2-methylpropanoic acid;hydrate?
azane;2-methylpropanoic acid;hydrate has a molecular weight of 123.15 g/mol, XLogP of 0.06, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;2-methylpropanoic acid;hydrate is sourced from PubChem (CID 161320294), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).