cyanamide;2-methylpropanoic acid

C5H10N2O2 — CID 172748410

IUPACcyanamide;2-methylpropanoic acid
SMILESCC(C)C(=O)O.N#CN
InChIInChI=1S/C4H8O2.CH2N2/c1-3(2)4(5)6;2-1-3/h3H,1-2H3,(H,5,6);2H2
InChIKeyKAONHGRODYSRSG-UHFFFAOYSA-N
MW130.15 g/mol
LogP0.15
Rot. Bonds1

About cyanamide;2-methylpropanoic acid

cyanamide;2-methylpropanoic acid (PubChem CID 172748410) has the molecular formula C5H10N2O2 and a molecular weight of 130.15 g/mol. Its IUPAC name is cyanamide;2-methylpropanoic acid.

Molecular Properties

Compound Namecyanamide;2-methylpropanoic acid
PubChem CID172748410
Molecular FormulaC5H10N2O2
Molecular Weight130.15 g/mol
Exact Mass130.07
IUPAC Namecyanamide;2-methylpropanoic acid
SMILESCC(C)C(=O)O.N#CN
InChIInChI=1S/C4H8O2.CH2N2/c1-3(2)4(5)6;2-1-3/h3H,1-2H3,(H,5,6);2H2
InChIKeyKAONHGRODYSRSG-UHFFFAOYSA-N
XLogP0.15
TPSA87.11 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500130.15
LogP ≤ 50.15
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}

Analyze cyanamide;2-methylpropanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyanamide;2-methylpropanoic acid?
The IUPAC name of cyanamide;2-methylpropanoic acid (CID 172748410) is cyanamide;2-methylpropanoic acid.
What is the SMILES notation for cyanamide;2-methylpropanoic acid?
The canonical SMILES for cyanamide;2-methylpropanoic acid is CC(C)C(=O)O.N#CN.
What is the InChIKey of cyanamide;2-methylpropanoic acid?
The InChIKey is KAONHGRODYSRSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.CH2N2/c1-3(2)4(5)6;2-1-3/h3H,1-2H3,(H,5,6);2H2.
What are the key properties of cyanamide;2-methylpropanoic acid?
cyanamide;2-methylpropanoic acid has a molecular weight of 130.15 g/mol, XLogP of 0.15, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyanamide;2-methylpropanoic acid is sourced from PubChem (CID 172748410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).