About cyanophosphonic acid;2-methylpropanoic acid
cyanophosphonic acid;2-methylpropanoic acid (PubChem CID 174906922) has the molecular formula C5H10NO5P
and a molecular weight of 195.11 g/mol. Its IUPAC name is cyanophosphonic acid;2-methylpropanoic acid.
Molecular Properties
| Compound Name | cyanophosphonic acid;2-methylpropanoic acid |
| PubChem CID | 174906922 |
| Molecular Formula | C5H10NO5P |
| Molecular Weight | 195.11 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | cyanophosphonic acid;2-methylpropanoic acid |
| SMILES | CC(C)C(=O)O.N#CP(=O)(O)O |
| InChI | InChI=1S/C4H8O2.CH2NO3P/c1-3(2)4(5)6;2-1-6(3,4)5/h3H,1-2H3,(H,5,6);(H2,3,4,5) |
| InChIKey | FASGYHSFKJAUFG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 118.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.11 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyanophosphonic acid;2-methylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyanophosphonic acid;2-methylpropanoic acid?
The IUPAC name of cyanophosphonic acid;2-methylpropanoic acid (CID 174906922) is cyanophosphonic acid;2-methylpropanoic acid.
What is the SMILES notation for cyanophosphonic acid;2-methylpropanoic acid?
The canonical SMILES for cyanophosphonic acid;2-methylpropanoic acid is CC(C)C(=O)O.N#CP(=O)(O)O.
What is the InChIKey of cyanophosphonic acid;2-methylpropanoic acid?
The InChIKey is FASGYHSFKJAUFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O2.CH2NO3P/c1-3(2)4(5)6;2-1-6(3,4)5/h3H,1-2H3,(H,5,6);(H2,3,4,5).
What are the key properties of cyanophosphonic acid;2-methylpropanoic acid?
cyanophosphonic acid;2-methylpropanoic acid has a molecular weight of 195.11 g/mol, XLogP of 0.37, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyanophosphonic acid;2-methylpropanoic acid is sourced from PubChem (CID 174906922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).