C10H22O5 — CID 89370097
(3S,4S,6S)-7,7-dimethyloctane-1,3,4,5,6-pentol (PubChem CID 89370097) has the molecular formula C10H22O5 and a molecular weight of 222.28 g/mol. Its IUPAC name is (3S,4S,6S)-7,7-dimethyloctane-1,3,4,5,6-pentol.
| Compound Name | (3S,4S,6S)-7,7-dimethyloctane-1,3,4,5,6-pentol |
|---|---|
| PubChem CID | 89370097 |
| Molecular Formula | C10H22O5 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | (3S,4S,6S)-7,7-dimethyloctane-1,3,4,5,6-pentol |
| SMILES | CC(C)(C)[C@H](O)C(O)[C@@H](O)[C@@H](O)CCO |
| InChI | InChI=1S/C10H22O5/c1-10(2,3)9(15)8(14)7(13)6(12)4-5-11/h6-9,11-15H,4-5H2,1-3H3/t6-,7-,8?,9+/m0/s1 |
| InChIKey | YYRIBHJTSAOQOR-HAYPURPSSA-N |
| XLogP | -1.14 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |