C23H33NO3 — CID 100917202
(3S,4R,5S)-3-(dibenzylamino)-6,6-dimethylheptane-1,4,5-triol (PubChem CID 100917202) has the molecular formula C23H33NO3 and a molecular weight of 371.52 g/mol. Its IUPAC name is (3S,4R,5S)-3-(dibenzylamino)-6,6-dimethylheptane-1,4,5-triol.
| Compound Name | (3S,4R,5S)-3-(dibenzylamino)-6,6-dimethylheptane-1,4,5-triol |
|---|---|
| PubChem CID | 100917202 |
| Molecular Formula | C23H33NO3 |
| Molecular Weight | 371.52 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | (3S,4R,5S)-3-(dibenzylamino)-6,6-dimethylheptane-1,4,5-triol |
| SMILES | CC(C)(C)[C@H](O)[C@H](O)[C@H](CCO)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C23H33NO3/c1-23(2,3)22(27)21(26)20(14-15-25)24(16-18-10-6-4-7-11-18)17-19-12-8-5-9-13-19/h4-13,20-22,25-27H,14-17H2,1-3H3/t20-,21+,22+/m0/s1 |
| InChIKey | UMHHEHLSDHVWCZ-BHDDXSALSA-N |
| XLogP | 3.21 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |