C25H35NOSi — CID 101257956
(3S,4R)-4-(dibenzylamino)-2,2-dimethyl-6-trimethylsilylhex-5-yn-3-ol (PubChem CID 101257956) has the molecular formula C25H35NOSi and a molecular weight of 393.65 g/mol. Its IUPAC name is (3S,4R)-4-(dibenzylamino)-2,2-dimethyl-6-trimethylsilylhex-5-yn-3-ol.
| Compound Name | (3S,4R)-4-(dibenzylamino)-2,2-dimethyl-6-trimethylsilylhex-5-yn-3-ol |
|---|---|
| PubChem CID | 101257956 |
| Molecular Formula | C25H35NOSi |
| Molecular Weight | 393.65 g/mol |
| Exact Mass | 393.25 |
| IUPAC Name | (3S,4R)-4-(dibenzylamino)-2,2-dimethyl-6-trimethylsilylhex-5-yn-3-ol |
| SMILES | CC(C)(C)[C@H](O)[C@@H](C#C[Si](C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H35NOSi/c1-25(2,3)24(27)23(17-18-28(4,5)6)26(19-21-13-9-7-10-14-21)20-22-15-11-8-12-16-22/h7-16,23-24,27H,19-20H2,1-6H3/t23-,24-/m1/s1 |
| InChIKey | SATMMBADFMQDGP-DNQXCXABSA-N |
| XLogP | 5.35 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.65 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|