C25H29NO2 — CID 50901274
(1R,2S)-1-(dibenzylamino)-3-methyl-1-phenylbutane-2,3-diol (PubChem CID 50901274) has the molecular formula C25H29NO2 and a molecular weight of 375.51 g/mol. Its IUPAC name is (1R,2S)-1-(dibenzylamino)-3-methyl-1-phenylbutane-2,3-diol.
| Compound Name | (1R,2S)-1-(dibenzylamino)-3-methyl-1-phenylbutane-2,3-diol |
|---|---|
| PubChem CID | 50901274 |
| Molecular Formula | C25H29NO2 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | (1R,2S)-1-(dibenzylamino)-3-methyl-1-phenylbutane-2,3-diol |
| SMILES | CC(C)(O)[C@@H](O)[C@@H](c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H29NO2/c1-25(2,28)24(27)23(22-16-10-5-11-17-22)26(18-20-12-6-3-7-13-20)19-21-14-8-4-9-15-21/h3-17,23-24,27-28H,18-19H2,1-2H3/t23-,24+/m1/s1 |
| InChIKey | KVJDMMTUBRHBHM-RPWUZVMVSA-N |
| XLogP | 4.56 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |