C21H30N2O — CID 10687602
(3R,4S)-1-amino-4-(dibenzylamino)-2,2-dimethylpentan-3-ol (PubChem CID 10687602) has the molecular formula C21H30N2O and a molecular weight of 326.48 g/mol. Its IUPAC name is (3R,4S)-1-amino-4-(dibenzylamino)-2,2-dimethylpentan-3-ol.
| Compound Name | (3R,4S)-1-amino-4-(dibenzylamino)-2,2-dimethylpentan-3-ol |
|---|---|
| PubChem CID | 10687602 |
| Molecular Formula | C21H30N2O |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.24 |
| IUPAC Name | (3R,4S)-1-amino-4-(dibenzylamino)-2,2-dimethylpentan-3-ol |
| SMILES | C[C@@H]([C@H](O)C(C)(C)CN)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H30N2O/c1-17(20(24)21(2,3)16-22)23(14-18-10-6-4-7-11-18)15-19-12-8-5-9-13-19/h4-13,17,20,24H,14-16,22H2,1-3H3/t17-,20-/m0/s1 |
| InChIKey | SIIDUVJYNZSYHN-PXNSSMCTSA-N |
| XLogP | 3.42 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |