C24H33NO3 — CID 22868419
tert-butyl (4S)-5-(dibenzylamino)-4-hydroxyhexanoate (PubChem CID 22868419) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is tert-butyl (4S)-5-(dibenzylamino)-4-hydroxyhexanoate.
| Compound Name | tert-butyl (4S)-5-(dibenzylamino)-4-hydroxyhexanoate |
|---|---|
| PubChem CID | 22868419 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | tert-butyl (4S)-5-(dibenzylamino)-4-hydroxyhexanoate |
| SMILES | CC([C@@H](O)CCC(=O)OC(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C24H33NO3/c1-19(22(26)15-16-23(27)28-24(2,3)4)25(17-20-11-7-5-8-12-20)18-21-13-9-6-10-14-21/h5-14,19,22,26H,15-18H2,1-4H3/t19?,22-/m0/s1 |
| InChIKey | AIUKFQUKIXJNQJ-BPARTEKVSA-N |
| XLogP | 4.56 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |