C25H35NO3 — CID 10596976
tert-butyl (3R,4R)-4-(dibenzylamino)-3-hydroxy-5-methylhexanoate (PubChem CID 10596976) has the molecular formula C25H35NO3 and a molecular weight of 397.56 g/mol. Its IUPAC name is tert-butyl (3R,4R)-4-(dibenzylamino)-3-hydroxy-5-methylhexanoate.
| Compound Name | tert-butyl (3R,4R)-4-(dibenzylamino)-3-hydroxy-5-methylhexanoate |
|---|---|
| PubChem CID | 10596976 |
| Molecular Formula | C25H35NO3 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.26 |
| IUPAC Name | tert-butyl (3R,4R)-4-(dibenzylamino)-3-hydroxy-5-methylhexanoate |
| SMILES | CC(C)[C@H]([C@H](O)CC(=O)OC(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H35NO3/c1-19(2)24(22(27)16-23(28)29-25(3,4)5)26(17-20-12-8-6-9-13-20)18-21-14-10-7-11-15-21/h6-15,19,22,24,27H,16-18H2,1-5H3/t22-,24-/m1/s1 |
| InChIKey | ABHRISAGCBWHSS-ISKFKSNPSA-N |
| XLogP | 4.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |