C27H31NO3 — CID 14463509
ethyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-phenylpentanoate (PubChem CID 14463509) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is ethyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-phenylpentanoate.
| Compound Name | ethyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-phenylpentanoate |
|---|---|
| PubChem CID | 14463509 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | ethyl (3S,4S)-4-(dibenzylamino)-3-hydroxy-5-phenylpentanoate |
| SMILES | CCOC(=O)C[C@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H31NO3/c1-2-31-27(30)19-26(29)25(18-22-12-6-3-7-13-22)28(20-23-14-8-4-9-15-23)21-24-16-10-5-11-17-24/h3-17,25-26,29H,2,18-21H2,1H3/t25-,26-/m0/s1 |
| InChIKey | UYVRRFFKNWDNPF-UIOOFZCWSA-N |
| XLogP | 4.61 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |