C25H29NO — CID 58894379
(2R,3R)-2-(dibenzylamino)-1-phenylpentan-3-ol (PubChem CID 58894379) has the molecular formula C25H29NO and a molecular weight of 359.51 g/mol. Its IUPAC name is (2R,3R)-2-(dibenzylamino)-1-phenylpentan-3-ol.
| Compound Name | (2R,3R)-2-(dibenzylamino)-1-phenylpentan-3-ol |
|---|---|
| PubChem CID | 58894379 |
| Molecular Formula | C25H29NO |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | (2R,3R)-2-(dibenzylamino)-1-phenylpentan-3-ol |
| SMILES | CC[C@@H](O)[C@@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C25H29NO/c1-2-25(27)24(18-21-12-6-3-7-13-21)26(19-22-14-8-4-9-15-22)20-23-16-10-5-11-17-23/h3-17,24-25,27H,2,18-20H2,1H3/t24-,25-/m1/s1 |
| InChIKey | FSAAOINTNBCPBE-JWQCQUIFSA-N |
| XLogP | 5.07 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |