C29H37NOS — CID 102512935
(2R,3S)-3-(dibenzylamino)-1-pentylsulfanyl-4-phenylbutan-2-ol (PubChem CID 102512935) has the molecular formula C29H37NOS and a molecular weight of 447.69 g/mol. Its IUPAC name is (2R,3S)-3-(dibenzylamino)-1-pentylsulfanyl-4-phenylbutan-2-ol.
| Compound Name | (2R,3S)-3-(dibenzylamino)-1-pentylsulfanyl-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 102512935 |
| Molecular Formula | C29H37NOS |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.26 |
| IUPAC Name | (2R,3S)-3-(dibenzylamino)-1-pentylsulfanyl-4-phenylbutan-2-ol |
| SMILES | CCCCCSC[C@H](O)[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H37NOS/c1-2-3-13-20-32-24-29(31)28(21-25-14-7-4-8-15-25)30(22-26-16-9-5-10-17-26)23-27-18-11-6-12-19-27/h4-12,14-19,28-29,31H,2-3,13,20-24H2,1H3/t28-,29-/m0/s1 |
| InChIKey | YXKANHOHXXIBOL-VMPREFPWSA-N |
| XLogP | 6.58 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|